C22H30N4O4 — CID 135693200
(2R,3R)-N-hydroxy-N'-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-2-phenylethyl]-3-(2-methylpropyl)-2-prop-2-enylbutanediamide (PubChem CID 135693200) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is (2R,3R)-N-hydroxy-N'-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-2-phenylethyl]-3-(2-methylpropyl)-2-prop-2-enylbutanediamide.
| Compound Name | (2R,3R)-N-hydroxy-N'-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-2-phenylethyl]-3-(2-methylpropyl)-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 135693200 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (2R,3R)-N-hydroxy-N'-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-2-phenylethyl]-3-(2-methylpropyl)-2-prop-2-enylbutanediamide |
| SMILES | C=CC[C@@H](C(=O)NO)[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)c1nc(C)no1 |
| InChI | InChI=1S/C22H30N4O4/c1-5-9-17(21(28)25-29)18(12-14(2)3)20(27)24-19(22-23-15(4)26-30-22)13-16-10-7-6-8-11-16/h5-8,10-11,14,17-19,29H,1,9,12-13H2,2-4H3,(H,24,27)(H,25,28)/t17-,18-,19+/m1/s1 |
| InChIKey | MVAHKXOUWDLOMX-QRVBRYPASA-N |
| XLogP | 3.14 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|