C28H22N2O8 — CID 135697191
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-diazoacetyl)oxolan-2-yl]methyl benzoate (PubChem CID 135697191) has the molecular formula C28H22N2O8 and a molecular weight of 514.49 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-diazoacetyl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-diazoacetyl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 135697191 |
| Molecular Formula | C28H22N2O8 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2-diazoacetyl)oxolan-2-yl]methyl benzoate |
| SMILES | [N-]=[N+]=CC(=O)[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H22N2O8/c29-30-16-21(31)23-25(38-28(34)20-14-8-3-9-15-20)24(37-27(33)19-12-6-2-7-13-19)22(36-23)17-35-26(32)18-10-4-1-5-11-18/h1-16,22-25H,17H2/t22-,23+,24-,25+/m1/s1 |
| InChIKey | CYQXNPQMRROTAO-RCTAOEEJSA-N |
| XLogP | 2.93 |
| TPSA | 141.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|