C12H6N4OS2 — CID 135699650
11-thiophen-2-yl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 135699650) has the molecular formula C12H6N4OS2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 11-thiophen-2-yl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 11-thiophen-2-yl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 135699650 |
| Molecular Formula | C12H6N4OS2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 11-thiophen-2-yl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | O=c1[nH]nnc2c1sc1nc(-c3cccs3)ccc12 |
| InChI | InChI=1S/C12H6N4OS2/c17-11-10-9(14-16-15-11)6-3-4-7(13-12(6)19-10)8-2-1-5-18-8/h1-5H,(H,14,15,17) |
| InChIKey | BVLNHGJOWFISFB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |