C20H25N3O5S — CID 135702652
[2-[cyclohexen-1-yl(ethyl)amino]-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135702652) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is [2-[cyclohexen-1-yl(ethyl)amino]-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-[cyclohexen-1-yl(ethyl)amino]-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135702652 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [2-[cyclohexen-1-yl(ethyl)amino]-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | CCN(C(=O)COC(=O)[C@H](C)/N=C1\NS(=O)(=O)c2ccccc21)C1=CCCCC1 |
| InChI | InChI=1S/C20H25N3O5S/c1-3-23(15-9-5-4-6-10-15)18(24)13-28-20(25)14(2)21-19-16-11-7-8-12-17(16)29(26,27)22-19/h7-9,11-12,14H,3-6,10,13H2,1-2H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | KLMZQTBHYCQDLE-AWEZNQCLSA-N |
| XLogP | 1.96 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|