C13H18N3O2S2+ — CID 135703100
N-[2-[(E)-2-(dimethylamino)ethenyl]-3-methyl-1,3-benzothiazol-3-ium-6-yl]methanesulfonamide (PubChem CID 135703100) has the molecular formula C13H18N3O2S2+ and a molecular weight of 312.44 g/mol. Its IUPAC name is N-[2-[(E)-2-(dimethylamino)ethenyl]-3-methyl-1,3-benzothiazol-3-ium-6-yl]methanesulfonamide.
| Compound Name | N-[2-[(E)-2-(dimethylamino)ethenyl]-3-methyl-1,3-benzothiazol-3-ium-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 135703100 |
| Molecular Formula | C13H18N3O2S2+ |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-[2-[(E)-2-(dimethylamino)ethenyl]-3-methyl-1,3-benzothiazol-3-ium-6-yl]methanesulfonamide |
| SMILES | CN(C)/C=C/c1sc2cc(NS(C)(=O)=O)ccc2[n+]1C |
| InChI | InChI=1S/C13H18N3O2S2/c1-15(2)8-7-13-16(3)11-6-5-10(9-12(11)19-13)14-20(4,17)18/h5-9,14H,1-4H3/q+1 |
| InChIKey | DTOFBCPURRWKPA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 53.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|