C23H30N4OS+2 — CID 123959958
[2-[[2-[2-[4-(dimethylamino)phenyl]ethenyl]-3-methyl-1,3-benzothiazol-3-ium-6-yl]amino]-2-oxoethyl]-trimethylazanium (PubChem CID 123959958) has the molecular formula C23H30N4OS+2 and a molecular weight of 410.59 g/mol. Its IUPAC name is [2-[[2-[2-[4-(dimethylamino)phenyl]ethenyl]-3-methyl-1,3-benzothiazol-3-ium-6-yl]amino]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[[2-[2-[4-(dimethylamino)phenyl]ethenyl]-3-methyl-1,3-benzothiazol-3-ium-6-yl]amino]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 123959958 |
| Molecular Formula | C23H30N4OS+2 |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [2-[[2-[2-[4-(dimethylamino)phenyl]ethenyl]-3-methyl-1,3-benzothiazol-3-ium-6-yl]amino]-2-oxoethyl]-trimethylazanium |
| SMILES | CN(C)c1ccc(C=Cc2sc3cc(NC(=O)C[N+](C)(C)C)ccc3[n+]2C)cc1 |
| InChI | InChI=1S/C23H29N4OS/c1-25(2)19-11-7-17(8-12-19)9-14-23-26(3)20-13-10-18(15-21(20)29-23)24-22(28)16-27(4,5)6/h7-15H,16H2,1-6H3/q+1/p+1 |
| InChIKey | AWOPTPXIGSBQAR-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 36.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|