C27H24N2O2 — CID 135704440
(NE)-N-[(2Z,5Z,7Z,13Z,15Z,17E,18Z)-17-hydroxyimino-8,13-dimethyl-4-bicyclo[18.4.1]pentacosa-1(24),2,5,7,13,15,18,20,22-nonaen-9,11-diynylidene]hydroxylamine (PubChem CID 135704440) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is (NE)-N-[(2Z,5Z,7Z,13Z,15Z,17E,18Z)-17-hydroxyimino-8,13-dimethyl-4-bicyclo[18.4.1]pentacosa-1(24),2,5,7,13,15,18,20,22-nonaen-9,11-diynylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2Z,5Z,7Z,13Z,15Z,17E,18Z)-17-hydroxyimino-8,13-dimethyl-4-bicyclo[18.4.1]pentacosa-1(24),2,5,7,13,15,18,20,22-nonaen-9,11-diynylidene]hydroxylamine |
|---|---|
| PubChem CID | 135704440 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (NE)-N-[(2Z,5Z,7Z,13Z,15Z,17E,18Z)-17-hydroxyimino-8,13-dimethyl-4-bicyclo[18.4.1]pentacosa-1(24),2,5,7,13,15,18,20,22-nonaen-9,11-diynylidene]hydroxylamine |
| SMILES | C/C1=C/C=C\C(=N/O)\C=C\C2=CC=CC=C(/C=C/C(=N/O)/C=C/C=C(/C)C#CC#C1)C2 |
| InChI | InChI=1S/C27H24N2O2/c1-22-9-3-4-10-23(2)12-8-16-27(29-31)20-18-25-14-6-5-13-24(21-25)17-19-26(28-30)15-7-11-22/h5-8,11-20,30-31H,21H2,1-2H3/b15-7-,16-8-,19-17+,20-18+,22-11-,23-12-,28-26+,29-27+ |
| InChIKey | HDZHGNYMHHRJNI-LZEJYZPHSA-N |
| XLogP | 5.60 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|