C32H30N4O — CID 135712441
(Z)-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]methanol (PubChem CID 135712441) has the molecular formula C32H30N4O and a molecular weight of 486.62 g/mol. Its IUPAC name is (Z)-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]methanol.
| Compound Name | (Z)-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]methanol |
|---|---|
| PubChem CID | 135712441 |
| Molecular Formula | C32H30N4O |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (Z)-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]methanol |
| SMILES | Cc1cc(C)c(/C2=C3\C=CC(=N3)/C=C3/C=CC(=N3)/C=C3\N/C(=C\C4=NC2=C/C4=C/O)CC3(C)C)c(C)c1 |
| InChI | InChI=1S/C32H30N4O/c1-18-10-19(2)30(20(3)11-18)31-26-9-8-23(34-26)13-22-6-7-24(33-22)15-29-32(4,5)16-25(35-29)14-27-21(17-37)12-28(31)36-27/h6-15,17,35,37H,16H2,1-5H3/b21-17-,22-13-,25-14-,29-15-,31-26+ |
| InChIKey | SAZIAANKORJNNW-BTGMVGLCSA-N |
| XLogP | 6.81 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|