C40H40N4O — CID 136628052
1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-7,18,22,23-tetrahydroporphyrin-2-ylidene]ethanol (PubChem CID 136628052) has the molecular formula C40H40N4O and a molecular weight of 592.79 g/mol. Its IUPAC name is 1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-7,18,22,23-tetrahydroporphyrin-2-ylidene]ethanol.
| Compound Name | 1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-7,18,22,23-tetrahydroporphyrin-2-ylidene]ethanol |
|---|---|
| PubChem CID | 136628052 |
| Molecular Formula | C40H40N4O |
| Molecular Weight | 592.79 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | 1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-7,18,22,23-tetrahydroporphyrin-2-ylidene]ethanol |
| SMILES | CC(O)=C1C=c2nc1cc1nc(cc3ccc([nH]3)c(-c3ccc(C)cc3)c3[nH]c(c2-c2c(C)cc(C)cc2C)CC=3)C(C)(C)C1 |
| InChI | InChI=1S/C40H40N4O/c1-22-8-10-27(11-9-22)38-31-13-12-28(41-31)19-36-40(6,7)21-29(42-36)18-34-30(26(5)45)20-35(44-34)39(33-15-14-32(38)43-33)37-24(3)16-23(2)17-25(37)4/h8-14,16-20,41,43,45H,15,21H2,1-7H3/b28-19-,29-18-,30-26?,38-31-,39-33+ |
| InChIKey | QRGLYQPSUNRRTO-FDDFZEEISA-N |
| XLogP | 7.92 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.79 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|