C38H32N4 — CID 68634405
2,3-bis(2,4,6-trimethylphenyl)porphyrin (PubChem CID 68634405) has the molecular formula C38H32N4 and a molecular weight of 544.70 g/mol. Its IUPAC name is 2,3-bis(2,4,6-trimethylphenyl)porphyrin.
| Compound Name | 2,3-bis(2,4,6-trimethylphenyl)porphyrin |
|---|---|
| PubChem CID | 68634405 |
| Molecular Formula | C38H32N4 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 2,3-bis(2,4,6-trimethylphenyl)porphyrin |
| SMILES | Cc1cc(C)c(C2=C(c3c(C)cc(C)cc3C)/C3=C/C4=N/C(=C\C5=N/C(=C\C6=N/C(=C\C2=N3)C=C6)C=C5)C=C4)c(C)c1 |
| InChI | InChI=1S/C38H32N4/c1-21-13-23(3)35(24(4)14-21)37-33-19-31-11-9-29(40-31)17-27-7-8-28(39-27)18-30-10-12-32(41-30)20-34(42-33)38(37)36-25(5)15-22(2)16-26(36)6/h7-20H,1-6H3/b27-17-,28-18-,29-17-,30-18-,31-19-,32-20-,33-19-,34-20- |
| InChIKey | XDDQLMHTROMYOY-IZOYJUGISA-N |
| XLogP | 8.48 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|