C29H30N2 — CID 139115765
7,7-dimethyl-4,10-bis(2,4,6-trimethylphenyl)-5,9-diazatricyclo[6.3.0.02,6]undeca-1,3,5,8,10-pentaene (PubChem CID 139115765) has the molecular formula C29H30N2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 7,7-dimethyl-4,10-bis(2,4,6-trimethylphenyl)-5,9-diazatricyclo[6.3.0.02,6]undeca-1,3,5,8,10-pentaene.
| Compound Name | 7,7-dimethyl-4,10-bis(2,4,6-trimethylphenyl)-5,9-diazatricyclo[6.3.0.02,6]undeca-1,3,5,8,10-pentaene |
|---|---|
| PubChem CID | 139115765 |
| Molecular Formula | C29H30N2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 7,7-dimethyl-4,10-bis(2,4,6-trimethylphenyl)-5,9-diazatricyclo[6.3.0.02,6]undeca-1,3,5,8,10-pentaene |
| SMILES | Cc1cc(C)c(C2=CC3=C4C=C(c5c(C)cc(C)cc5C)N=C4C(C)(C)C3=N2)c(C)c1 |
| InChI | InChI=1S/C29H30N2/c1-15-9-17(3)25(18(4)10-15)23-13-21-22-14-24(26-19(5)11-16(2)12-20(26)6)31-28(22)29(7,8)27(21)30-23/h9-14H,1-8H3 |
| InChIKey | YZZJYWWDDAQLSQ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |