C11H16N5O3+ — CID 135727015
6-[(E)-(carbamoylhydrazinylidene)methyl]-5-hydroxy-N,N,1-trimethylpyridin-1-ium-3-carboxamide (PubChem CID 135727015) has the molecular formula C11H16N5O3+ and a molecular weight of 266.28 g/mol. Its IUPAC name is 6-[(E)-(carbamoylhydrazinylidene)methyl]-5-hydroxy-N,N,1-trimethylpyridin-1-ium-3-carboxamide.
| Compound Name | 6-[(E)-(carbamoylhydrazinylidene)methyl]-5-hydroxy-N,N,1-trimethylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 135727015 |
| Molecular Formula | C11H16N5O3+ |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 6-[(E)-(carbamoylhydrazinylidene)methyl]-5-hydroxy-N,N,1-trimethylpyridin-1-ium-3-carboxamide |
| SMILES | CN(C)C(=O)c1cc(O)c(/C=N/NC(N)=O)[n+](C)c1 |
| InChI | InChI=1S/C11H15N5O3/c1-15(2)10(18)7-4-9(17)8(16(3)6-7)5-13-14-11(12)19/h4-6H,1-3H3,(H3,12,17,19)/p+1 |
| InChIKey | LXOUGANUKRHSDL-UHFFFAOYSA-O |
| XLogP | -1.08 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|