C10H12ClN3O2 — CID 168533781
[(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]urea (PubChem CID 168533781) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is [(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]urea.
| Compound Name | [(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 168533781 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | [(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]urea |
| SMILES | Cc1cc(O)c(C=NNC(N)=O)c(C)c1Cl |
| InChI | InChI=1S/C10H12ClN3O2/c1-5-3-8(15)7(6(2)9(5)11)4-13-14-10(12)16/h3-4,15H,1-2H3,(H3,12,14,16) |
| InChIKey | FOWQCTINVYSCQM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|