C17H17ClN2O5 — CID 137150625
N-[(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]-3,4-dihydroxy-5-methoxybenzamide (PubChem CID 137150625) has the molecular formula C17H17ClN2O5 and a molecular weight of 364.79 g/mol. Its IUPAC name is N-[(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]-3,4-dihydroxy-5-methoxybenzamide.
| Compound Name | N-[(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]-3,4-dihydroxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 137150625 |
| Molecular Formula | C17H17ClN2O5 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-[(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]-3,4-dihydroxy-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NN=Cc2c(O)cc(C)c(Cl)c2C)cc(O)c1O |
| InChI | InChI=1S/C17H17ClN2O5/c1-8-4-12(21)11(9(2)15(8)18)7-19-20-17(24)10-5-13(22)16(23)14(6-10)25-3/h4-7,21-23H,1-3H3,(H,20,24) |
| InChIKey | DNLUFPCRGDBZPR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|