C17H16ClNO4 — CID 149014518
2-[(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 149014518) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is 2-[(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-[(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 149014518 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-[(3-chloro-6-hydroxy-2,4-dimethylphenyl)methylideneamino]-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | Cc1cc(O)c(/C=N/CC(=O)c2ccc(O)c(O)c2)c(C)c1Cl |
| InChI | InChI=1S/C17H16ClNO4/c1-9-5-14(21)12(10(2)17(9)18)7-19-8-16(23)11-3-4-13(20)15(22)6-11/h3-7,20-22H,8H2,1-2H3/b19-7+ |
| InChIKey | QCGSYFGHNKJCDQ-FBCYGCLPSA-N |
| XLogP | 3.38 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|