C22H15Cl2NO4 — CID 159981351
2-[(3-benzoyl-2,4-dichlorophenyl)methylideneamino]-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 159981351) has the molecular formula C22H15Cl2NO4 and a molecular weight of 428.27 g/mol. Its IUPAC name is 2-[(3-benzoyl-2,4-dichlorophenyl)methylideneamino]-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-[(3-benzoyl-2,4-dichlorophenyl)methylideneamino]-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 159981351 |
| Molecular Formula | C22H15Cl2NO4 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 2-[(3-benzoyl-2,4-dichlorophenyl)methylideneamino]-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | O=C(C/N=C/c1ccc(Cl)c(C(=O)c2ccccc2)c1Cl)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H15Cl2NO4/c23-16-8-6-15(21(24)20(16)22(29)13-4-2-1-3-5-13)11-25-12-19(28)14-7-9-17(26)18(27)10-14/h1-11,26-27H,12H2/b25-11+ |
| InChIKey | OFURWRONLOKVSM-OPEKNORGSA-N |
| XLogP | 4.94 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|