C24H22ClNO5 — CID 23043610
2-(3-chloro-6-hydroxy-2,4-dimethylphenyl)-N-[4-[2-(3,4-dihydroxyphenyl)ethyl]phenyl]-2-oxoacetamide (PubChem CID 23043610) has the molecular formula C24H22ClNO5 and a molecular weight of 439.90 g/mol. Its IUPAC name is 2-(3-chloro-6-hydroxy-2,4-dimethylphenyl)-N-[4-[2-(3,4-dihydroxyphenyl)ethyl]phenyl]-2-oxoacetamide.
| Compound Name | 2-(3-chloro-6-hydroxy-2,4-dimethylphenyl)-N-[4-[2-(3,4-dihydroxyphenyl)ethyl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 23043610 |
| Molecular Formula | C24H22ClNO5 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-(3-chloro-6-hydroxy-2,4-dimethylphenyl)-N-[4-[2-(3,4-dihydroxyphenyl)ethyl]phenyl]-2-oxoacetamide |
| SMILES | Cc1cc(O)c(C(=O)C(=O)Nc2ccc(CCc3ccc(O)c(O)c3)cc2)c(C)c1Cl |
| InChI | InChI=1S/C24H22ClNO5/c1-13-11-20(29)21(14(2)22(13)25)23(30)24(31)26-17-8-5-15(6-9-17)3-4-16-7-10-18(27)19(28)12-16/h5-12,27-29H,3-4H2,1-2H3,(H,26,31) |
| InChIKey | LPPWFQQQRFVYAE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|