C21H16ClN3O6S — CID 135729974
(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 135729974) has the molecular formula C21H16ClN3O6S and a molecular weight of 473.89 g/mol. Its IUPAC name is (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 135729974 |
| Molecular Formula | C21H16ClN3O6S |
| Molecular Weight | 473.89 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(OCc1nc2cc(Cl)ccc2c(=O)[nH]1)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C21H16ClN3O6S/c22-14-5-8-17-18(10-14)24-19(25-20(17)26)12-31-21(27)13-3-6-16(7-4-13)32(28,29)23-11-15-2-1-9-30-15/h1-10,23H,11-12H2,(H,24,25,26) |
| InChIKey | NSGJSDMUSYBNKT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.89 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |