C20H16N2O5S — CID 135733675
6,8-dihydroxy-N-(5-hydroxyquinolin-8-yl)-5-methylnaphthalene-2-sulfonamide (PubChem CID 135733675) has the molecular formula C20H16N2O5S and a molecular weight of 396.42 g/mol. Its IUPAC name is 6,8-dihydroxy-N-(5-hydroxyquinolin-8-yl)-5-methylnaphthalene-2-sulfonamide.
| Compound Name | 6,8-dihydroxy-N-(5-hydroxyquinolin-8-yl)-5-methylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 135733675 |
| Molecular Formula | C20H16N2O5S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 6,8-dihydroxy-N-(5-hydroxyquinolin-8-yl)-5-methylnaphthalene-2-sulfonamide |
| SMILES | Cc1c(O)cc(O)c2cc(S(=O)(=O)Nc3ccc(O)c4cccnc34)ccc12 |
| InChI | InChI=1S/C20H16N2O5S/c1-11-13-5-4-12(9-15(13)19(25)10-18(11)24)28(26,27)22-16-6-7-17(23)14-3-2-8-21-20(14)16/h2-10,22-25H,1H3 |
| InChIKey | NZVHALOYKLMROF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|