C17H15NO7S2 — CID 21022709
3-[(6,8-dihydroxy-5-methylnaphthalen-2-yl)sulfonylamino]benzenesulfonic acid (PubChem CID 21022709) has the molecular formula C17H15NO7S2 and a molecular weight of 409.44 g/mol. Its IUPAC name is 3-[(6,8-dihydroxy-5-methylnaphthalen-2-yl)sulfonylamino]benzenesulfonic acid.
| Compound Name | 3-[(6,8-dihydroxy-5-methylnaphthalen-2-yl)sulfonylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 21022709 |
| Molecular Formula | C17H15NO7S2 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 3-[(6,8-dihydroxy-5-methylnaphthalen-2-yl)sulfonylamino]benzenesulfonic acid |
| SMILES | Cc1c(O)cc(O)c2cc(S(=O)(=O)Nc3cccc(S(=O)(=O)O)c3)ccc12 |
| InChI | InChI=1S/C17H15NO7S2/c1-10-14-6-5-12(8-15(14)17(20)9-16(10)19)26(21,22)18-11-3-2-4-13(7-11)27(23,24)25/h2-9,18-20H,1H3,(H,23,24,25) |
| InChIKey | SOKYZEUYEZYABX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|