C16H25NO3 — CID 135735785
4-[(E)-N-methoxy-C-octylcarbonimidoyl]benzene-1,2-diol (PubChem CID 135735785) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 4-[(E)-N-methoxy-C-octylcarbonimidoyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-N-methoxy-C-octylcarbonimidoyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135735785 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 4-[(E)-N-methoxy-C-octylcarbonimidoyl]benzene-1,2-diol |
| SMILES | CCCCCCCC/C(=N\OC)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H25NO3/c1-3-4-5-6-7-8-9-14(17-20-2)13-10-11-15(18)16(19)12-13/h10-12,18-19H,3-9H2,1-2H3/b17-14+ |
| InChIKey | NIDVCACBMIQALN-SAPNQHFASA-N |
| XLogP | 4.20 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|