C19H31NO3 — CID 135953075
4-[(E)-N-methoxy-C-undecylcarbonimidoyl]benzene-1,2-diol (PubChem CID 135953075) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 4-[(E)-N-methoxy-C-undecylcarbonimidoyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-N-methoxy-C-undecylcarbonimidoyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135953075 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 4-[(E)-N-methoxy-C-undecylcarbonimidoyl]benzene-1,2-diol |
| SMILES | CCCCCCCCCCC/C(=N\OC)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H31NO3/c1-3-4-5-6-7-8-9-10-11-12-17(20-23-2)16-13-14-18(21)19(22)15-16/h13-15,21-22H,3-12H2,1-2H3/b20-17+ |
| InChIKey | UMNTTZSRBZAMFB-LVZFUZTISA-N |
| XLogP | 5.37 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|