C27H36ClNO6S — CID 135746247
(3E,6S,10S,13S,14S,15S)-3-chloro-13-ethyl-10,14-dihydroxy-11,11,15-trimethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1,7-dioxacyclohexadec-3-ene-8,12-dione (PubChem CID 135746247) has the molecular formula C27H36ClNO6S and a molecular weight of 538.11 g/mol. Its IUPAC name is (3E,6S,10S,13S,14S,15S)-3-chloro-13-ethyl-10,14-dihydroxy-11,11,15-trimethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1,7-dioxacyclohexadec-3-ene-8,12-dione.
| Compound Name | (3E,6S,10S,13S,14S,15S)-3-chloro-13-ethyl-10,14-dihydroxy-11,11,15-trimethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1,7-dioxacyclohexadec-3-ene-8,12-dione |
|---|---|
| PubChem CID | 135746247 |
| Molecular Formula | C27H36ClNO6S |
| Molecular Weight | 538.11 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | (3E,6S,10S,13S,14S,15S)-3-chloro-13-ethyl-10,14-dihydroxy-11,11,15-trimethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1,7-dioxacyclohexadec-3-ene-8,12-dione |
| SMILES | CC[C@@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](c2ccc3sc(C)nc3c2)C/C=C(/Cl)COC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C27H36ClNO6S/c1-6-19-25(32)15(2)13-34-14-18(28)8-9-21(17-7-10-22-20(11-17)29-16(3)36-22)35-24(31)12-23(30)27(4,5)26(19)33/h7-8,10-11,15,19,21,23,25,30,32H,6,9,12-14H2,1-5H3/b18-8+/t15-,19-,21-,23-,25-/m0/s1 |
| InChIKey | DUGBTDKVURTTGD-OPAYWYGOSA-N |
| XLogP | 5.10 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.11 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |