C27H37ClN2O5S — CID 10208965
(3E,6S,10S,13R,14S,15S)-3-chloro-13-ethyl-10,14-dihydroxy-11,11,15-trimethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1-oxa-7-azacyclohexadec-3-ene-8,12-dione (PubChem CID 10208965) has the molecular formula C27H37ClN2O5S and a molecular weight of 537.12 g/mol. Its IUPAC name is (3E,6S,10S,13R,14S,15S)-3-chloro-13-ethyl-10,14-dihydroxy-11,11,15-trimethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1-oxa-7-azacyclohexadec-3-ene-8,12-dione.
| Compound Name | (3E,6S,10S,13R,14S,15S)-3-chloro-13-ethyl-10,14-dihydroxy-11,11,15-trimethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1-oxa-7-azacyclohexadec-3-ene-8,12-dione |
|---|---|
| PubChem CID | 10208965 |
| Molecular Formula | C27H37ClN2O5S |
| Molecular Weight | 537.12 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | (3E,6S,10S,13R,14S,15S)-3-chloro-13-ethyl-10,14-dihydroxy-11,11,15-trimethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1-oxa-7-azacyclohexadec-3-ene-8,12-dione |
| SMILES | CC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)N[C@H](c2ccc3sc(C)nc3c2)C/C=C(/Cl)COC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C27H37ClN2O5S/c1-6-19-25(33)15(2)13-35-14-18(28)8-9-20(17-7-10-22-21(11-17)29-16(3)36-22)30-24(32)12-23(31)27(4,5)26(19)34/h7-8,10-11,15,19-20,23,25,31,33H,6,9,12-14H2,1-5H3,(H,30,32)/b18-8+/t15-,19+,20-,23-,25-/m0/s1 |
| InChIKey | ZYJPCFFIUQVPQL-HOTBLOHYSA-N |
| XLogP | 4.67 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.12 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |