C29H39NO5S — CID 59732609
(3S,7S,10R,11S,12S,13E)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-4-oxabicyclo[14.1.0]heptadec-13-ene-5,9-dione (PubChem CID 59732609) has the molecular formula C29H39NO5S and a molecular weight of 513.70 g/mol. Its IUPAC name is (3S,7S,10R,11S,12S,13E)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-4-oxabicyclo[14.1.0]heptadec-13-ene-5,9-dione.
| Compound Name | (3S,7S,10R,11S,12S,13E)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-4-oxabicyclo[14.1.0]heptadec-13-ene-5,9-dione |
|---|---|
| PubChem CID | 59732609 |
| Molecular Formula | C29H39NO5S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | (3S,7S,10R,11S,12S,13E)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-4-oxabicyclo[14.1.0]heptadec-13-ene-5,9-dione |
| SMILES | Cc1nc2cc([C@@H]3CC4CC4(C)C/C=C/[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O3)ccc2s1 |
| InChI | InChI=1S/C29H39NO5S/c1-16-8-7-11-29(6)15-20(29)13-22(19-9-10-23-21(12-19)30-18(3)36-23)35-25(32)14-24(31)28(4,5)27(34)17(2)26(16)33/h7-10,12,16-17,20,22,24,26,31,33H,11,13-15H2,1-6H3/b8-7+/t16-,17+,20?,22-,24-,26-,29?/m0/s1 |
| InChIKey | JNNUTHUMXDWYOV-HCZSSTMPSA-N |
| XLogP | 5.54 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|