C28H37NO7 — CID 20817565
(13Z)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzoxazol-5-yl)-4,17-dioxabicyclo[14.1.0]heptadec-13-ene-5,9-dione (PubChem CID 20817565) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is (13Z)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzoxazol-5-yl)-4,17-dioxabicyclo[14.1.0]heptadec-13-ene-5,9-dione.
| Compound Name | (13Z)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzoxazol-5-yl)-4,17-dioxabicyclo[14.1.0]heptadec-13-ene-5,9-dione |
|---|---|
| PubChem CID | 20817565 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (13Z)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzoxazol-5-yl)-4,17-dioxabicyclo[14.1.0]heptadec-13-ene-5,9-dione |
| SMILES | Cc1nc2cc(C3CC4OC4(C)C/C=C\C(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O3)ccc2o1 |
| InChI | InChI=1S/C28H37NO7/c1-15-8-7-11-28(6)23(36-28)13-21(18-9-10-20-19(12-18)29-17(3)34-20)35-24(31)14-22(30)27(4,5)26(33)16(2)25(15)32/h7-10,12,15-16,21-23,25,30,32H,11,13-14H2,1-6H3/b8-7- |
| InChIKey | VTPXVCTTWUTHPW-FPLPWBNLSA-N |
| XLogP | 4.21 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|