C29H39NO7 — CID 59732555
(7S,11S,14R,15S,16S)-11,15-dihydroxy-3,12,12,14,16-pentamethyl-7-(2-methyl-1,3-benzoxazol-5-yl)-4,8-dioxatricyclo[15.1.0.03,5]octadecane-9,13-dione (PubChem CID 59732555) has the molecular formula C29H39NO7 and a molecular weight of 513.63 g/mol. Its IUPAC name is (7S,11S,14R,15S,16S)-11,15-dihydroxy-3,12,12,14,16-pentamethyl-7-(2-methyl-1,3-benzoxazol-5-yl)-4,8-dioxatricyclo[15.1.0.03,5]octadecane-9,13-dione.
| Compound Name | (7S,11S,14R,15S,16S)-11,15-dihydroxy-3,12,12,14,16-pentamethyl-7-(2-methyl-1,3-benzoxazol-5-yl)-4,8-dioxatricyclo[15.1.0.03,5]octadecane-9,13-dione |
|---|---|
| PubChem CID | 59732555 |
| Molecular Formula | C29H39NO7 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | (7S,11S,14R,15S,16S)-11,15-dihydroxy-3,12,12,14,16-pentamethyl-7-(2-methyl-1,3-benzoxazol-5-yl)-4,8-dioxatricyclo[15.1.0.03,5]octadecane-9,13-dione |
| SMILES | Cc1nc2cc([C@@H]3CC4OC4(C)CC4CC4[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O3)ccc2o1 |
| InChI | InChI=1S/C29H39NO7/c1-14-19-9-18(19)13-29(6)24(37-29)11-22(17-7-8-21-20(10-17)30-16(3)35-21)36-25(32)12-23(31)28(4,5)27(34)15(2)26(14)33/h7-8,10,14-15,18-19,22-24,26,31,33H,9,11-13H2,1-6H3/t14-,15+,18?,19?,22-,23-,24?,26-,29?/m0/s1 |
| InChIKey | DJGVOOSNVVCZNK-WPUAGEQUSA-N |
| XLogP | 4.29 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|