C28H38N2O6 — CID 59732510
(3Z,6S,10S,13R,14S,15S)-10,14-dihydroxy-3,11,11,13,15-pentamethyl-6-(2-methyl-1,3-benzoxazol-5-yl)-7-oxa-17-azabicyclo[14.1.0]heptadec-3-ene-8,12-dione (PubChem CID 59732510) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is (3Z,6S,10S,13R,14S,15S)-10,14-dihydroxy-3,11,11,13,15-pentamethyl-6-(2-methyl-1,3-benzoxazol-5-yl)-7-oxa-17-azabicyclo[14.1.0]heptadec-3-ene-8,12-dione.
| Compound Name | (3Z,6S,10S,13R,14S,15S)-10,14-dihydroxy-3,11,11,13,15-pentamethyl-6-(2-methyl-1,3-benzoxazol-5-yl)-7-oxa-17-azabicyclo[14.1.0]heptadec-3-ene-8,12-dione |
|---|---|
| PubChem CID | 59732510 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | (3Z,6S,10S,13R,14S,15S)-10,14-dihydroxy-3,11,11,13,15-pentamethyl-6-(2-methyl-1,3-benzoxazol-5-yl)-7-oxa-17-azabicyclo[14.1.0]heptadec-3-ene-8,12-dione |
| SMILES | C/C1=C/C[C@@H](c2ccc3oc(C)nc3c2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)C2NC2C1 |
| InChI | InChI=1S/C28H38N2O6/c1-14-7-9-21(18-8-10-22-19(12-18)29-17(4)35-22)36-24(32)13-23(31)28(5,6)27(34)16(3)26(33)15(2)25-20(11-14)30-25/h7-8,10,12,15-16,20-21,23,25-26,30-31,33H,9,11,13H2,1-6H3/b14-7-/t15-,16+,20?,21-,23-,25?,26-/m0/s1 |
| InChIKey | XYIBWEUJUHAAIL-YDZIIATHSA-N |
| XLogP | 3.78 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|