C64H62N4O8 — CID 135746549
butyl 4-[15,20-bis(4-butoxycarbonylphenyl)-10-[4-[butoxy(hydroxy)methylidene]cyclohexa-2,5-dien-1-ylidene]-23H-porphyrin-5-yl]benzoate (PubChem CID 135746549) has the molecular formula C64H62N4O8 and a molecular weight of 1015.22 g/mol. Its IUPAC name is butyl 4-[15,20-bis(4-butoxycarbonylphenyl)-10-[4-[butoxy(hydroxy)methylidene]cyclohexa-2,5-dien-1-ylidene]-23H-porphyrin-5-yl]benzoate.
| Compound Name | butyl 4-[15,20-bis(4-butoxycarbonylphenyl)-10-[4-[butoxy(hydroxy)methylidene]cyclohexa-2,5-dien-1-ylidene]-23H-porphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 135746549 |
| Molecular Formula | C64H62N4O8 |
| Molecular Weight | 1015.22 g/mol |
| Exact Mass | 1014.46 |
| IUPAC Name | butyl 4-[15,20-bis(4-butoxycarbonylphenyl)-10-[4-[butoxy(hydroxy)methylidene]cyclohexa-2,5-dien-1-ylidene]-23H-porphyrin-5-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(/C2=C3\C=CC(=N3)C(=c3ccc(=C(O)OCCCC)cc3)c3ccc([nH]3)/C(c3ccc(C(=O)OCCCC)cc3)=C3/C=CC(=N3)/C(c3ccc(C(=O)OCCCC)cc3)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C64H62N4O8/c1-5-9-37-73-61(69)45-21-13-41(14-22-45)57-49-29-31-51(65-49)58(42-15-23-46(24-16-42)62(70)74-38-10-6-2)53-33-35-55(67-53)60(44-19-27-48(28-20-44)64(72)76-40-12-8-4)56-36-34-54(68-56)59(52-32-30-50(57)66-52)43-17-25-47(26-18-43)63(71)75-39-11-7-3/h13-36,65,69H,5-12,37-40H2,1-4H3/b57-41-,58-53-,59-52-,60-56-,61-45+ |
| InChIKey | WYRWHKFBBRKJRF-AXGGIWSQSA-N |
| XLogP | 12.15 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.22 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|