C26H20N4OS — CID 135747445
2-(1,3-benzothiazol-2-yl)-4-(2,3-dihydro-1H-inden-2-yliminomethyl)-5-phenyl-1H-pyrazol-3-one (PubChem CID 135747445) has the molecular formula C26H20N4OS and a molecular weight of 436.54 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-(2,3-dihydro-1H-inden-2-yliminomethyl)-5-phenyl-1H-pyrazol-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-(2,3-dihydro-1H-inden-2-yliminomethyl)-5-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135747445 |
| Molecular Formula | C26H20N4OS |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-(2,3-dihydro-1H-inden-2-yliminomethyl)-5-phenyl-1H-pyrazol-3-one |
| SMILES | O=c1c(/C=N/C2Cc3ccccc3C2)c(-c2ccccc2)[nH]n1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H20N4OS/c31-25-21(16-27-20-14-18-10-4-5-11-19(18)15-20)24(17-8-2-1-3-9-17)29-30(25)26-28-22-12-6-7-13-23(22)32-26/h1-13,16,20,29H,14-15H2/b27-16+ |
| InChIKey | FXZXCYUJVUMGQG-JVWAILMASA-N |
| XLogP | 5.03 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|