C14H22N2O6 — CID 135753399
tert-butyl [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] carbonate (PubChem CID 135753399) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is tert-butyl [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] carbonate.
| Compound Name | tert-butyl [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] carbonate |
|---|---|
| PubChem CID | 135753399 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | tert-butyl [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] carbonate |
| SMILES | CC(=O)C(=[N+]=[N-])[C@H](OC(=O)OC(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H22N2O6/c1-8(17)10(16-15)11(9-7-19-14(5,6)21-9)20-12(18)22-13(2,3)4/h9,11H,7H2,1-6H3/t9-,11-/m1/s1 |
| InChIKey | JAHSQGOSWAGILV-MWLCHTKSSA-N |
| XLogP | 1.72 |
| TPSA | 107.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|