C21H16Cl3N5O2 — CID 135753588
N-[(4S,5S)-4,5-bis(4-chlorophenyl)-1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide (PubChem CID 135753588) has the molecular formula C21H16Cl3N5O2 and a molecular weight of 476.75 g/mol. Its IUPAC name is N-[(4S,5S)-4,5-bis(4-chlorophenyl)-1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide.
| Compound Name | N-[(4S,5S)-4,5-bis(4-chlorophenyl)-1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 135753588 |
| Molecular Formula | C21H16Cl3N5O2 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | N-[(4S,5S)-4,5-bis(4-chlorophenyl)-1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide |
| SMILES | O=[N+]([O-])N=C1N[C@@H](c2ccc(Cl)cc2)[C@H](c2ccc(Cl)cc2)N1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C21H16Cl3N5O2/c22-16-6-2-14(3-7-16)19-20(15-4-8-17(23)9-5-15)28(21(26-19)27-29(30)31)12-13-1-10-18(24)25-11-13/h1-11,19-20H,12H2,(H,26,27)/t19-,20-/m0/s1 |
| InChIKey | GNJLUSHETYTPAI-PMACEKPBSA-N |
| XLogP | 5.48 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|