C9H10ClN5O3 — CID 151991476
1-[(6-chloro-3-pyridinyl)methyl]-5-imino-2-nitroimidazolidin-4-ol (PubChem CID 151991476) has the molecular formula C9H10ClN5O3 and a molecular weight of 271.66 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-5-imino-2-nitroimidazolidin-4-ol.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-5-imino-2-nitroimidazolidin-4-ol |
|---|---|
| PubChem CID | 151991476 |
| Molecular Formula | C9H10ClN5O3 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-5-imino-2-nitroimidazolidin-4-ol |
| SMILES | [H]/N=C1\C(O)NC([N+](=O)[O-])N1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H10ClN5O3/c10-6-2-1-5(3-12-6)4-14-7(11)8(16)13-9(14)15(17)18/h1-3,8-9,11,13,16H,4H2/b11-7+ |
| InChIKey | UETMXXQFKMBHGD-YRNVUSSQSA-N |
| XLogP | -0.00 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|