C20H26ClN2O2+ — CID 135758516
[(1R)-1-(2-chlorophenyl)-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyl]-diethylazanium (PubChem CID 135758516) has the molecular formula C20H26ClN2O2+ and a molecular weight of 361.89 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyl]-diethylazanium.
| Compound Name | [(1R)-1-(2-chlorophenyl)-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyl]-diethylazanium |
|---|---|
| PubChem CID | 135758516 |
| Molecular Formula | C20H26ClN2O2+ |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyl]-diethylazanium |
| SMILES | CC[NH+](CC)[C@@H](C/N=C/c1cccc(OC)c1O)c1ccccc1Cl |
| InChI | InChI=1S/C20H25ClN2O2/c1-4-23(5-2)18(16-10-6-7-11-17(16)21)14-22-13-15-9-8-12-19(25-3)20(15)24/h6-13,18,24H,4-5,14H2,1-3H3/p+1/b22-13+/t18-/m0/s1 |
| InChIKey | XSIJSPSKULBOIX-ZFJBLLOBSA-O |
| XLogP | 3.14 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|