C21H22N6O — CID 135762324
2-amino-1'-pentylspiro[1H-[1,3,5]triazino[1,2-a]benzimidazole-4,3'-indole]-2'-one (PubChem CID 135762324) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-amino-1'-pentylspiro[1H-[1,3,5]triazino[1,2-a]benzimidazole-4,3'-indole]-2'-one.
| Compound Name | 2-amino-1'-pentylspiro[1H-[1,3,5]triazino[1,2-a]benzimidazole-4,3'-indole]-2'-one |
|---|---|
| PubChem CID | 135762324 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-amino-1'-pentylspiro[1H-[1,3,5]triazino[1,2-a]benzimidazole-4,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(N=C(N)Nc3nc4ccccc4n32)c2ccccc21 |
| InChI | InChI=1S/C21H22N6O/c1-2-3-8-13-26-16-11-6-4-9-14(16)21(18(26)28)25-19(22)24-20-23-15-10-5-7-12-17(15)27(20)21/h4-7,9-12H,2-3,8,13H2,1H3,(H3,22,23,24,25) |
| InChIKey | SCXNXYHCIGPMSQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|