C21H22N2O3S — CID 58872510
3-hydroxy-3-(5-hydroxy-2-methyl-1,3-benzothiazol-6-yl)-1-pentylindol-2-one (PubChem CID 58872510) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 3-hydroxy-3-(5-hydroxy-2-methyl-1,3-benzothiazol-6-yl)-1-pentylindol-2-one.
| Compound Name | 3-hydroxy-3-(5-hydroxy-2-methyl-1,3-benzothiazol-6-yl)-1-pentylindol-2-one |
|---|---|
| PubChem CID | 58872510 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-hydroxy-3-(5-hydroxy-2-methyl-1,3-benzothiazol-6-yl)-1-pentylindol-2-one |
| SMILES | CCCCCN1C(=O)C(O)(c2cc3sc(C)nc3cc2O)c2ccccc21 |
| InChI | InChI=1S/C21H22N2O3S/c1-3-4-7-10-23-17-9-6-5-8-14(17)21(26,20(23)25)15-11-19-16(12-18(15)24)22-13(2)27-19/h5-6,8-9,11-12,24,26H,3-4,7,10H2,1-2H3 |
| InChIKey | NKILVSIQYDBXPY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|