C28H31N10NaO7 — CID 135763198
sodium 2-[(2-amino-8-hydroxy-6-methylnaphthalen-1-yl)diazenyl]-5-[[4-[(3-aminooxy-3-oxopropyl)amino]-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 135763198) has the molecular formula C28H31N10NaO7 and a molecular weight of 642.61 g/mol. Its IUPAC name is sodium 2-[(2-amino-8-hydroxy-6-methylnaphthalen-1-yl)diazenyl]-5-[[4-[(3-aminooxy-3-oxopropyl)amino]-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | sodium 2-[(2-amino-8-hydroxy-6-methylnaphthalen-1-yl)diazenyl]-5-[[4-[(3-aminooxy-3-oxopropyl)amino]-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 135763198 |
| Molecular Formula | C28H31N10NaO7 |
| Molecular Weight | 642.61 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | sodium 2-[(2-amino-8-hydroxy-6-methylnaphthalen-1-yl)diazenyl]-5-[[4-[(3-aminooxy-3-oxopropyl)amino]-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | Cc1cc(O)c2c(/N=N/c3ccc(Nc4nc(NCCC(=O)ON)nc(N(CCO)CCO)n4)cc3C(=O)[O-])c(N)ccc2c1.[Na+] |
| InChI | InChI=1S/C28H32N10O7.Na/c1-15-12-16-2-4-19(29)24(23(16)21(41)13-15)37-36-20-5-3-17(14-18(20)25(43)44)32-27-33-26(31-7-6-22(42)45-30)34-28(35-27)38(8-10-39)9-11-40;/h2-5,12-14,39-41H,6-11,29-30H2,1H3,(H,43,44)(H2,31,32,33,34,35);/q;+1/p-1/b37-36+; |
| InChIKey | JILOSCCJSHBEAH-ODMOXECGSA-M |
| XLogP | -1.84 |
| TPSA | 269.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.61 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|