C30H29N5OS — CID 135793522
2-benzylsulfanyl-N-(2,4-dimethylphenyl)-5-methyl-7-[(E)-2-phenylethenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135793522) has the molecular formula C30H29N5OS and a molecular weight of 507.66 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(2,4-dimethylphenyl)-5-methyl-7-[(E)-2-phenylethenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-benzylsulfanyl-N-(2,4-dimethylphenyl)-5-methyl-7-[(E)-2-phenylethenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135793522 |
| Molecular Formula | C30H29N5OS |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 2-benzylsulfanyl-N-(2,4-dimethylphenyl)-5-methyl-7-[(E)-2-phenylethenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(/C=C/c2ccccc2)n2nc(SCc3ccccc3)nc2N1 |
| InChI | InChI=1S/C30H29N5OS/c1-20-14-16-25(21(2)18-20)32-28(36)27-22(3)31-29-33-30(37-19-24-12-8-5-9-13-24)34-35(29)26(27)17-15-23-10-6-4-7-11-23/h4-18,26H,19H2,1-3H3,(H,32,36)(H,31,33,34)/b17-15+ |
| InChIKey | WPRWEPXUASJQIE-BMRADRMJSA-N |
| XLogP | 6.78 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |