C14H12N4O6S — CID 135793980
3-[3-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-5-oxo-4H-1,2,4-triazin-6-yl]propanoic acid (PubChem CID 135793980) has the molecular formula C14H12N4O6S and a molecular weight of 364.34 g/mol. Its IUPAC name is 3-[3-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-5-oxo-4H-1,2,4-triazin-6-yl]propanoic acid.
| Compound Name | 3-[3-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-5-oxo-4H-1,2,4-triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 135793980 |
| Molecular Formula | C14H12N4O6S |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 3-[3-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-5-oxo-4H-1,2,4-triazin-6-yl]propanoic acid |
| SMILES | O=C(O)CCc1nnc(SCC(=O)c2ccc([N+](=O)[O-])cc2)[nH]c1=O |
| InChI | InChI=1S/C14H12N4O6S/c19-11(8-1-3-9(4-2-8)18(23)24)7-25-14-15-13(22)10(16-17-14)5-6-12(20)21/h1-4H,5-7H2,(H,20,21)(H,15,17,22) |
| InChIKey | AJXWRQFDCAQJHY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|