C11H14N6O6 — CID 135795308
ethyl (Z)-2-[[[4-(hydrazinecarbonyl)-1,2,5-oxadiazole-3-carbonyl]hydrazinylidene]methyl]-3-hydroxybut-2-enoate (PubChem CID 135795308) has the molecular formula C11H14N6O6 and a molecular weight of 326.27 g/mol. Its IUPAC name is ethyl (Z)-2-[[[4-(hydrazinecarbonyl)-1,2,5-oxadiazole-3-carbonyl]hydrazinylidene]methyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl (Z)-2-[[[4-(hydrazinecarbonyl)-1,2,5-oxadiazole-3-carbonyl]hydrazinylidene]methyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135795308 |
| Molecular Formula | C11H14N6O6 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | ethyl (Z)-2-[[[4-(hydrazinecarbonyl)-1,2,5-oxadiazole-3-carbonyl]hydrazinylidene]methyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)/C(C=NNC(=O)c1nonc1C(=O)NN)=C(/C)O |
| InChI | InChI=1S/C11H14N6O6/c1-3-22-11(21)6(5(2)18)4-13-15-10(20)8-7(9(19)14-12)16-23-17-8/h4,18H,3,12H2,1-2H3,(H,14,19)(H,15,20)/b6-5-,13-4? |
| InChIKey | NUDTXHGLOPLPTG-UJLSKWQOSA-N |
| XLogP | -1.22 |
| TPSA | 182.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|