About 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine
1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine (PubChem CID 135796571) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine.
Molecular Properties
| Compound Name | 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine |
| PubChem CID | 135796571 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine |
| SMILES | O/N=C\C=N/O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C2H4N2O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;5-3-1-2-4-6/h1-10H;1-2,5-6H/b;3-1-,4-2- |
| InChIKey | JTWWLFIDGOXEGI-SSSHPFEYSA-N |
| XLogP | 3.26 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine?
The IUPAC name of 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine (CID 135796571) is 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine.
What is the SMILES notation for 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine?
The canonical SMILES for 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine is O/N=C\C=N/O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine?
The InChIKey is JTWWLFIDGOXEGI-SSSHPFEYSA-N. The full InChI is InChI=1S/C12H10.C2H4N2O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;5-3-1-2-4-6/h1-10H;1-2,5-6H/b;3-1-,4-2-.
What are the key properties of 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine?
1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine has a molecular weight of 242.28 g/mol, XLogP of 3.26, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;(NZ)-N-[(2Z)-2-hydroxyiminoethylidene]hydroxylamine is sourced from PubChem (CID 135796571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).