C15H14BrClN3OS+ — CID 135811812
(5-bromothiophen-2-yl)methyl-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-methylazanium (PubChem CID 135811812) has the molecular formula C15H14BrClN3OS+ and a molecular weight of 399.72 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)methyl-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-methylazanium.
| Compound Name | (5-bromothiophen-2-yl)methyl-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 135811812 |
| Molecular Formula | C15H14BrClN3OS+ |
| Molecular Weight | 399.72 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | (5-bromothiophen-2-yl)methyl-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-methylazanium |
| SMILES | C[NH+](Cc1nc2cc(Cl)ccc2c(=O)[nH]1)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C15H13BrClN3OS/c1-20(7-10-3-5-13(16)22-10)8-14-18-12-6-9(17)2-4-11(12)15(21)19-14/h2-6H,7-8H2,1H3,(H,18,19,21)/p+1 |
| InChIKey | CRUYVILJRISEDJ-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |