C19H17N5O2S — CID 135811971
(2R)-2-(1,3-benzothiazol-2-ylamino)-N-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]propanamide (PubChem CID 135811971) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is (2R)-2-(1,3-benzothiazol-2-ylamino)-N-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]propanamide.
| Compound Name | (2R)-2-(1,3-benzothiazol-2-ylamino)-N-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]propanamide |
|---|---|
| PubChem CID | 135811971 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (2R)-2-(1,3-benzothiazol-2-ylamino)-N-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]propanamide |
| SMILES | Cc1cccc2c(/N=N/C(=O)[C@@H](C)Nc3nc4ccccc4s3)c(O)[nH]c12 |
| InChI | InChI=1S/C19H17N5O2S/c1-10-6-5-7-12-15(10)22-18(26)16(12)23-24-17(25)11(2)20-19-21-13-8-3-4-9-14(13)27-19/h3-9,11,22,26H,1-2H3,(H,20,21)/b24-23+/t11-/m1/s1 |
| InChIKey | CGCWAWVLHMPKNJ-SJOCPNOISA-N |
| XLogP | 4.90 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|