C10H18N6O3 — CID 135818386
2-amino-4-(6-aminohexylamino)-5-nitro-1H-pyrimidin-6-one (PubChem CID 135818386) has the molecular formula C10H18N6O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-amino-4-(6-aminohexylamino)-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-(6-aminohexylamino)-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135818386 |
| Molecular Formula | C10H18N6O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-amino-4-(6-aminohexylamino)-5-nitro-1H-pyrimidin-6-one |
| SMILES | NCCCCCCNc1nc(N)[nH]c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H18N6O3/c11-5-3-1-2-4-6-13-8-7(16(18)19)9(17)15-10(12)14-8/h1-6,11H2,(H4,12,13,14,15,17) |
| InChIKey | AAXWSKJHKWNSIH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 152.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|