C25H14N2O6S — CID 135818738
4-[(4-hydroxy-13-oxo-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-3-yl)diazenyl]benzenesulfonic acid (PubChem CID 135818738) has the molecular formula C25H14N2O6S and a molecular weight of 470.46 g/mol. Its IUPAC name is 4-[(4-hydroxy-13-oxo-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-3-yl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(4-hydroxy-13-oxo-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-3-yl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135818738 |
| Molecular Formula | C25H14N2O6S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 4-[(4-hydroxy-13-oxo-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-3-yl)diazenyl]benzenesulfonic acid |
| SMILES | O=C1c2ccccc2-c2c3c1cccc3cc1oc(O)c(/N=N/c3ccc(S(=O)(=O)O)cc3)c21 |
| InChI | InChI=1S/C25H14N2O6S/c28-24-17-6-2-1-5-16(17)21-20-13(4-3-7-18(20)24)12-19-22(21)23(25(29)33-19)27-26-14-8-10-15(11-9-14)34(30,31)32/h1-12,29H,(H,30,31,32)/b27-26+ |
| InChIKey | XSRHJWJGPSAOIA-CYYJNZCTSA-N |
| XLogP | 6.17 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|