C26H16N2O4 — CID 135818739
4-hydroxy-3-[(4-methoxyphenyl)diazenyl]-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-13-one (PubChem CID 135818739) has the molecular formula C26H16N2O4 and a molecular weight of 420.42 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-methoxyphenyl)diazenyl]-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-13-one.
| Compound Name | 4-hydroxy-3-[(4-methoxyphenyl)diazenyl]-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-13-one |
|---|---|
| PubChem CID | 135818739 |
| Molecular Formula | C26H16N2O4 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 4-hydroxy-3-[(4-methoxyphenyl)diazenyl]-5-oxapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),3,7,9,11,14,16,18-nonaen-13-one |
| SMILES | COc1ccc(/N=N/c2c(O)oc3cc4cccc5c4c(c23)-c2ccccc2C5=O)cc1 |
| InChI | InChI=1S/C26H16N2O4/c1-31-16-11-9-15(10-12-16)27-28-24-23-20(32-26(24)30)13-14-5-4-8-19-21(14)22(23)17-6-2-3-7-18(17)25(19)29/h2-13,30H,1H3/b28-27+ |
| InChIKey | LJCWKCQDYHMBDE-BYYHNAKLSA-N |
| XLogP | 6.93 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|