C23H33NO2 — CID 135819135
2-[3-(hydroxymethyl)-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]phenol (PubChem CID 135819135) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]phenol.
| Compound Name | 2-[3-(hydroxymethyl)-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]phenol |
|---|---|
| PubChem CID | 135819135 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 2-[3-(hydroxymethyl)-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]phenol |
| SMILES | CCCCCc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccccc1O |
| InChI | InChI=1S/C23H33NO2/c1-6-7-8-12-18-21(17-11-9-10-13-20(17)26)19(14-25)23(16(4)5)24-22(18)15(2)3/h9-11,13,15-16,25-26H,6-8,12,14H2,1-5H3 |
| InChIKey | YHYMRUYFZKGUMS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|