C22H35NO3Si — CID 135828013
(4S)-4-tert-butyl-3-[(3S)-3-[dimethyl(phenyl)silyl]heptanoyl]-1,3-oxazolidin-2-one (PubChem CID 135828013) has the molecular formula C22H35NO3Si and a molecular weight of 389.61 g/mol. Its IUPAC name is (4S)-4-tert-butyl-3-[(3S)-3-[dimethyl(phenyl)silyl]heptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-tert-butyl-3-[(3S)-3-[dimethyl(phenyl)silyl]heptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135828013 |
| Molecular Formula | C22H35NO3Si |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (4S)-4-tert-butyl-3-[(3S)-3-[dimethyl(phenyl)silyl]heptanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCC[C@@H](CC(=O)N1C(=O)OC[C@@H]1C(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H35NO3Si/c1-7-8-12-18(27(5,6)17-13-10-9-11-14-17)15-20(24)23-19(22(2,3)4)16-26-21(23)25/h9-11,13-14,18-19H,7-8,12,15-16H2,1-6H3/t18-,19+/m0/s1 |
| InChIKey | SKFRJDWZFPYZGG-RBUKOAKNSA-N |
| XLogP | 4.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|