C39H36N4O — CID 135829288
(E)-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]methanol (PubChem CID 135829288) has the molecular formula C39H36N4O and a molecular weight of 576.74 g/mol. Its IUPAC name is (E)-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]methanol.
| Compound Name | (E)-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]methanol |
|---|---|
| PubChem CID | 135829288 |
| Molecular Formula | C39H36N4O |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | (E)-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]methanol |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C=C3\N/C(=C\C4=NC(=C/C4=C\O)/C(c4c(C)cc(C)cc4C)=C4/C=CC2=N4)CC3(C)C)cc1 |
| InChI | InChI=1S/C39H36N4O/c1-22-7-9-26(10-8-22)37-30-12-11-28(40-30)19-35-39(5,6)20-29(41-35)18-33-27(21-44)17-34(43-33)38(32-14-13-31(37)42-32)36-24(3)15-23(2)16-25(36)4/h7-19,21,41,44H,20H2,1-6H3/b27-21+,29-18-,35-19-,37-30-,38-32+ |
| InChIKey | ZJBMPSPGPHOXPG-LNLSJGHFSA-N |
| XLogP | 8.65 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|