C22H15Cl2N5O3 — CID 135833334
2-(3,4-dichloroanilino)-6-methyl-5-nitro-8-[(E)-2-pyridin-4-ylethenyl]-3H-quinazolin-4-one (PubChem CID 135833334) has the molecular formula C22H15Cl2N5O3 and a molecular weight of 468.30 g/mol. Its IUPAC name is 2-(3,4-dichloroanilino)-6-methyl-5-nitro-8-[(E)-2-pyridin-4-ylethenyl]-3H-quinazolin-4-one.
| Compound Name | 2-(3,4-dichloroanilino)-6-methyl-5-nitro-8-[(E)-2-pyridin-4-ylethenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135833334 |
| Molecular Formula | C22H15Cl2N5O3 |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 2-(3,4-dichloroanilino)-6-methyl-5-nitro-8-[(E)-2-pyridin-4-ylethenyl]-3H-quinazolin-4-one |
| SMILES | Cc1cc(/C=C/c2ccncc2)c2nc(Nc3ccc(Cl)c(Cl)c3)[nH]c(=O)c2c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H15Cl2N5O3/c1-12-10-14(3-2-13-6-8-25-9-7-13)19-18(20(12)29(31)32)21(30)28-22(27-19)26-15-4-5-16(23)17(24)11-15/h2-11H,1H3,(H2,26,27,28,30)/b3-2+ |
| InChIKey | BPUDNIOLDSSMSQ-NSCUHMNNSA-N |
| XLogP | 5.76 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|